| Name | 2-Chloro-6-fluorophenylacetic acid |
| Synonyms | RARECHEM AL BO 0114 (2-chloro-6-fluorophenyl)acetate 2-CHLORO-6-FLUOROPHENYLACETIC ACID 2-Chloro-6-fluorophenylacetic acid (4-chloro-3-fluorophenyl)acetic acid 2-Chloro-6-fluoro-benzeneacetic Acid Benzeneacetic acid, 2-chloro-6-fluoro- 2-(2-CHLORO-6-FLUORO-PHENYL)ACETIC ACID 2-CHLORO-6-FLUOROPHENYL ACETIC ACID FOR 1,2-dichloro-3,3,4,4-tetrafluorocyclobutene |
| CAS | 37777-76-7 |
| EINECS | 253-661-4 |
| InChI | InChI=1/C8H6ClFO2/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H,11,12) |
| Molecular Formula | C8H6ClFO2 |
| Molar Mass | 188.58 |
| Density | 1.3379 (estimate) |
| Melting Point | 120-123°C(lit.) |
| Boling Point | 287.3±25.0 °C(Predicted) |
| Flash Point | 127.6°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.00116mmHg at 25°C |
| Appearance | Yellow crystal |
| Color | Off-White to Pale Yellow Crystalline |
| BRN | 4401142 |
| pKa | 3.77±0.10(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.548 |
| MDL | MFCD00004319 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S26/37/39 - S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 2916 39 90 |
| Hazard Class | IRRITANT |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |